Introduction：Basic information about CAS 1390661-72-9|Florpyrauxifen-benzyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Florpyrauxifen-benzyl |
|---|
| CAS Number | 1390661-72-9 | Molecular Weight | 439.24000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C20H14Cl2F2N2O3 | Melting Point | 132 - 133 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Florpyrauxifen-benzyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 132 - 133 °C |
|---|
| Molecular Formula | C20H14Cl2F2N2O3 |
|---|
| Molecular Weight | 439.24000 |
|---|
| Exact Mass | 438.03500 |
|---|
| PSA | 74.44000 |
|---|
| LogP | 5.86260 |
|---|
| InChIKey | WNZCDFOXYNRBRB-UHFFFAOYSA-N |
|---|
| SMILES | COc1c(Cl)ccc(-c2nc(C(=O)OCc3ccccc3)c(Cl)c(N)c2F)c1F |
|---|
Synonyms
| benzyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropicolinate |
| Benzyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylate |
| benzyl ester of 4-amino-3-chloro-5- fluoro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylic acid |
| 4-amino-3-chloro-5-fluoro-6-(4-chloro-2-fluoro-3-methoxy-phenyl)pyridine-2-carbox-ylic acid benzyl ester |
| 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylicbenzyl ester |
| Rinskor |
| 4-amino-3-chloro-5-fluoro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylic acid benzyl ester |
| benzyl ester of 4-amino-3-chloro-5-fluoro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylic acid |
| 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluo-ropyridine-2-carboxylic acid benzyl ester |
| Rinskor |
