Introduction:Basic information about CAS 4466-59-5|3,6-Dichlorophthalic anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,6-Dichlorophthalic anhydride |
|---|
| CAS Number | 4466-59-5 | Molecular Weight | 217.006 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 339.0±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H2Cl2O3 | Melting Point | 188-190 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 159.3±21.3 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3,6-Dichlorophthalic anhydride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 339.0±22.0 °C at 760 mmHg |
|---|
| Melting Point | 188-190 °C(lit.) |
|---|
| Molecular Formula | C8H2Cl2O3 |
|---|
| Molecular Weight | 217.006 |
|---|
| Flash Point | 159.3±21.3 °C |
|---|
| Exact Mass | 215.938095 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.72 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | HEGLMCPFDADCAQ-UHFFFAOYSA-N |
|---|
| SMILES | O=C1OC(=O)c2c(Cl)ccc(Cl)c21 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2932999099 |
|---|
Customs
| HS Code | 2932999099 |
|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,3-Isobenzofurandione, 4,7-dichloro- |
| 1,3-Isobenzofurandione,4,7-dichloro |
| 3,6-Dichloro-phthalic anhydride |
| 4,7-Dichloro-2-benzofuran-1,3-dione |
| 4,7-dichloroisobenzofuran-1,3-dione |
| EINECS 224-733-2 |
| 3,6-Dichlor-phthalsaeure-anhydrid |
| 4,7-dichloroisobenzofuran-1,3-quinone |
| 4,7-dichloro-1,3-dihydro-2-benzofuran-1,3-dione |
| 3,6-DICHLOROPHTHALIC ANHYDRIDE---WHITE POWDER |
| 4,7-dichlorophthalic anhydride |
| 3,6-dichloro-phthalic acid anhydride |
| 3,6-Dichlorophthalic anhydride |
| 4,7-Dichloro-1,3-isobenzofurandione |
| MFCD00042786 |