Introduction：Basic information about CAS 2549-99-7|Benzyl(triethoxy)silane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzyl(triethoxy)silane |
|---|
| CAS Number | 2549-99-7 | Molecular Weight | 254.398 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 247.5±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H22O3Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 102.9±26.2 °C |
|---|
Names
| Name | benzyl(triethoxy)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 247.5±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H22O3Si |
|---|
| Molecular Weight | 254.398 |
|---|
| Flash Point | 102.9±26.2 °C |
|---|
| Exact Mass | 254.133820 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 3.51 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.474 |
|---|
| InChIKey | CPLASELWOOUNGW-UHFFFAOYSA-N |
|---|
| SMILES | CCO[Si](Cc1ccccc1)(OCC)OCC |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Silane,triethoxy(phenylmethyl) |
| triethoxy(phenylmethyl)-silane |
| Triaethoxy-benzyl-silan |
| Benzene, [(triethoxysilyl)methyl]- |
| Benzene,((triethoxysilyl)methyl) |
| Orthosilicophenylessigsaeure-triaethylester |
| Benzylmonosilanorthosaeure-triaethylester |
| Silane, triethoxy(phenylmethyl)- |
| Benzyltriethoxysilane |
| Benzylorthosiliconsaeure-triaethylester |
| triethoxy-benzyl-silane |
| MFCD00026751 |
| Benzyl(triethoxy)silane |
| EINECS 219-841-1 |
