Introduction：Basic information about CAS 13154-25-1|Chlorotriisobutylsilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Chlorotriisobutylsilane |
|---|
| CAS Number | 13154-25-1 | Molecular Weight | 234.881 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 252.9±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H27ClSi | Melting Point | / |
|---|
| MSDS | / | Flash Point | 87.8±0.0 °C |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | chloro-tris(2-methylpropyl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 252.9±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H27ClSi |
|---|
| Molecular Weight | 234.881 |
|---|
| Flash Point | 87.8±0.0 °C |
|---|
| Exact Mass | 234.157059 |
|---|
| LogP | 6.41 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.431 |
|---|
| InChIKey | TZPZCTBZJKZFGY-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C[Si](Cl)(CC(C)C)CC(C)C |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | UN 2987 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Silane,chlorotris(2-methylpropyl) |
| Chlorotris(2-methylpropyl)silane |
| Chloro(triisobutyl)silane |
| Chlor-triisobutyl-silan |
| 1Y1&1-SI-G1Y1&1&1Y1&1 |
| Silane, chlorotris(2-methylpropyl)- |
| EINECS 454-150-0 |
| MFCD00010658 |
| Chlorotriisobutylsilane |
| chlorotriisobutyl silane |
| Triisobutylchlorosilane Triisobutylsilyl chloride |
| Triisobutylsilyl chloride |
| triisobutylchlorosilane |
