Introduction：Basic information about CAS 64792-79-6|4-Nitro-Z-Gly-Trp-Gly-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Nitro-Z-Gly-Trp-Gly-OH |
|---|
| CAS Number | 64792-79-6 | Molecular Weight | 497.457 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 965.4±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H23N5O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 537.6±34.3 °C |
|---|
Names
| Name | 4-Nitro-Z-Gly-Trp-Gly-OH |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 965.4±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H23N5O8 |
|---|
| Molecular Weight | 497.457 |
|---|
| Flash Point | 537.6±34.3 °C |
|---|
| Exact Mass | 497.154663 |
|---|
| PSA | 195.44000 |
|---|
| LogP | 2.19 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | FSSVAHQZIUZYJR-IBGZPJMESA-N |
|---|
| SMILES | O=C(O)CNC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)OCc1ccc([N+](=O)[O-])cc1 |
|---|
Synonyms
| Glycine, N-[[(4-nitrophenyl)methoxy]carbonyl]glycyl-L-tryptophyl- |
| N-{[(4-Nitrobenzyl)oxy]carbonyl}glycyl-L-tryptophylglycine |
| p-nitro-z-gly-trp-gly-oh |
