Introduction：Basic information about CAS 137309-88-7|2-(2-Methoxyphenoxy)ethyl 4-toluenesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2-Methoxyphenoxy)ethyl 4-toluenesulfonate |
|---|
| CAS Number | 137309-88-7 | Molecular Weight | 322.376 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 468.6±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H18O5S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 237.2±24.6 °C |
|---|
Names
| Name | 2-(2-methoxyphenoxy)ethyl 4-methylbenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 468.6±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H18O5S |
|---|
| Molecular Weight | 322.376 |
|---|
| Flash Point | 237.2±24.6 °C |
|---|
| Exact Mass | 322.087494 |
|---|
| PSA | 70.21000 |
|---|
| LogP | 3.04 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | JJYACKVCWURYDT-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccccc1OCCOS(=O)(=O)c1ccc(C)cc1 |
|---|
Synonyms
| 2-(1-CYCLOPROPYL-ETHYL)-5-METHYL-2H-PYRAZOL-3-YLAMINE |
| 2-(2-Methoxyphenoxy)ethyl 4-toluenesulfonate |
| Ethanol, 2-(2-methoxyphenoxy)-, 4-methylbenzenesulfonate |
| Ethanol,2-(2-methoxyphenoxy)-,1-(4-methylbenzenesulfonate) |
| Guaiacol ethyltosylate ether |
| 2-(2-Methoxyphenoxy)ethyl 4-methylbenzenesulfonate |
| Guaiacol O-ethyltosylate |
