Introduction:Basic information about CAS 4542-75-0|Bis[4-(bromomethyl)phenyl] ether, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis[4-(bromomethyl)phenyl] ether |
|---|
| CAS Number | 4542-75-0 | Molecular Weight | 356.052 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 396.6±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12Br2O | Melting Point | 94-96ºC |
|---|
| MSDS | / | Flash Point | 163.3±25.0 °C |
|---|
Names
| Name | 1-(bromomethyl)-4-[4-(bromomethyl)phenoxy]benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 396.6±37.0 °C at 760 mmHg |
|---|
| Melting Point | 94-96ºC |
|---|
| Molecular Formula | C14H12Br2O |
|---|
| Molecular Weight | 356.052 |
|---|
| Flash Point | 163.3±25.0 °C |
|---|
| Exact Mass | 353.925476 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 5.61 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | QPSFOUFNVQVKKJ-UHFFFAOYSA-N |
|---|
| SMILES | BrCc1ccc(Oc2ccc(CBr)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2903999090 |
|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| bis-(4-bromomethyl-phenyl)-ether |
| 4,4'-Di(bromomethyl)diphenyl ether |
| L585 |
| 4,4'-oxybis(benzyl bromide) |
| bis(p-bromomethylphenyl) ether |
| Bis-(4-brommethyl-phenyl)-aether |
| Benzene, 1,1'-oxybis[4-(bromomethyl)- |
| MFCD08063928 |
| 4,4'-Oxybis((bromomethyl)benzene) |
| 1,1'-Oxybis[4-(bromomethyl)benzene] |
| di-p-(bromomethyl)phenyl ether |
| Bis[4-(bromomethyl)phenyl] ether |