Introduction：Basic information about CAS 1694-92-4|o-Nitrophenylsulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | o-Nitrophenylsulfonyl chloride |
|---|
| CAS Number | 1694-92-4 | Molecular Weight | 221.618 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 350.6±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H4ClNO4S | Melting Point | 63-67 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 165.8±23.2 °C |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | 2-Nitrobenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 350.6±25.0 °C at 760 mmHg |
|---|
| Melting Point | 63-67 °C(lit.) |
|---|
| Molecular Formula | C6H4ClNO4S |
|---|
| Molecular Weight | 221.618 |
|---|
| Flash Point | 165.8±23.2 °C |
|---|
| Exact Mass | 220.954956 |
|---|
| PSA | 88.34000 |
|---|
| LogP | 2.00 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | WPHUUIODWRNJLO-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)Cl |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | UN 3261 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2-nitrosulfonyl chloride |
| o-Nitrobenzenesulfonyl chloride |
| Benzenesulfonyl chloride, o-nitro- |
| 2-Nitrobenzenesulfonyl chloride |
| Benzenesulfonyl chloride,o-nitro |
| O-NITROBENZENESULPHONYL CHLORIDE |
| o-Nitrobenzene sufonyl chloride |
| 2-Nosyl chloride |
| Benzenesulfonyl chloride, 2-nitro- |
| o-Nitrophenylsulfonyl chloride |
| o-nitrobenzensulfonyl chloride |
| Benzenesulfonyl chloride,2-nitro |
| 2-Nitrobenzenesulfonylchloride |
| MFCD00007430 |
| EINECS 216-907-1 |
| 2-Nitrobenzene-1-sulfonyl chloride |
| 2-Nitrobenzene sulfonyl chloride |
