Introduction：Basic information about CAS 31112-90-0|(2-PYRIDIN-3-YL-1,3-THIAZOL-4-YL)ACETIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2-PYRIDIN-3-YL-1,3-THIAZOL-4-YL)ACETIC ACID |
|---|
| CAS Number | 31112-90-0 | Molecular Weight | 220.24800 |
|---|
| Density | 1.393g/cm3 | Boiling Point | 457.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8N2O2S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 230.7ºC |
|---|
| Symbol |
GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetic acid |
|---|
Chemical & Physical Properties
| Density | 1.393g/cm3 |
|---|
| Boiling Point | 457.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8N2O2S |
|---|
| Molecular Weight | 220.24800 |
|---|
| Flash Point | 230.7ºC |
|---|
| Exact Mass | 220.03100 |
|---|
| PSA | 91.32000 |
|---|
| LogP | 1.83220 |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | ZKEORNUIZYBTGA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1csc(-c2cccnc2)n1 |
|---|
Safety Information
| Symbol |
GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H318 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
