Introduction：Basic information about CAS 52814-39-8|metesculetol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | metesculetol |
|---|
| CAS Number | 52814-39-8 | Molecular Weight | 250.20400 |
|---|
| Density | 1.483g/cm3 | Boiling Point | 530.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 211.5ºC |
|---|
Names
| Name | 2-(7-hydroxy-4-methyl-2-oxochromen-6-yl)oxyacetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.483g/cm3 |
|---|
| Boiling Point | 530.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10O6 |
|---|
| Molecular Weight | 250.20400 |
|---|
| Flash Point | 211.5ºC |
|---|
| Exact Mass | 250.04800 |
|---|
| PSA | 96.97000 |
|---|
| LogP | 1.27040 |
|---|
| Index of Refraction | 1.619 |
|---|
| InChIKey | VVDLFTOOMLZFRO-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(=O)oc2cc(O)c(OCC(=O)O)cc12 |
|---|
Synonyms
| Metesculetol |
| Metesculetolo |
| UNII-HO6I89Z64J |
| Metesculetolum |
| Permethol |
