Introduction：Basic information about CAS 65569-29-1|Cloxacepride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cloxacepride |
|---|
| CAS Number | 65569-29-1 | Molecular Weight | 468.37300 |
|---|
| Density | 1.269g/cm3 | Boiling Point | 616.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H27Cl2N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 326.7ºC |
|---|
Names
| Name | Cloxacepride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.269g/cm3 |
|---|
| Boiling Point | 616.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H27Cl2N3O4 |
|---|
| Molecular Weight | 468.37300 |
|---|
| Flash Point | 326.7ºC |
|---|
| Exact Mass | 467.13800 |
|---|
| PSA | 79.90000 |
|---|
| LogP | 4.55500 |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | VZNJZQAFQDEJOO-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)CCNC(=O)c1cc(Cl)c(NC(=O)COc2ccc(Cl)cc2)cc1OC |
|---|
Synonyms
| 5-Chloro-4-[(4-chlorophenoxy)acetylamino]-N-[2-(diethylamino)ethyl]-2-methoxybenzamide |
