Introduction:Basic information about CAS 178979-85-6|Capravirine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Capravirine |
|---|
| CAS Number | 178979-85-6 | Molecular Weight | 451.36900 |
|---|
| Density | 1.4g/cm3 | Boiling Point | 646ºC at 760mmHg |
|---|
| Molecular Formula | C20H20Cl2N4O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 344.5ºC |
|---|
Names
| Name | Capravirine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4g/cm3 |
|---|
| Boiling Point | 646ºC at 760mmHg |
|---|
| Molecular Formula | C20H20Cl2N4O2S |
|---|
| Molecular Weight | 451.36900 |
|---|
| Flash Point | 344.5ºC |
|---|
| Exact Mass | 450.06800 |
|---|
| PSA | 108.33000 |
|---|
| LogP | 6.20340 |
|---|
| Vapour Pressure | 1.42E-16mmHg at 25°C |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | YQXCVAGCMNFUMQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)c1nc(COC(N)=O)n(Cc2ccncc2)c1Sc1cc(Cl)cc(Cl)c1 |
|---|
Synonyms
| 5-(3,5-dichlorophenyl)thio-4-isopropyl-1-(pyridin-4-yl)methyl-1H-imidazol-2-ylmethyl carbamate |
| Cdimi |
| [5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methyl carbamate |
| 5-(3,5-Dichlorophenyl)thio-4-isopropyl-1-(4-pyridyl)methyl-1H-imidazol-2-ylmethyl carbamate |
| 2-carbamoyloxymethyl-5-(3,5-dichlorophenylthio)-4-isopropyl-1-(pyridin-4-yl)methyl-1H-imidazole |