Introduction：Basic information about CAS 131653-62-8|Propanamide, N-(4-iodo-2-methoxy-3-pyridinyl)-2,2-dimethyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Propanamide, N-(4-iodo-2-methoxy-3-pyridinyl)-2,2-dimethyl- |
|---|
| CAS Number | 131653-62-8 | Molecular Weight | 334.15300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H15IN2O2 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | N-(4-iodo-2-methoxypyridin-3-yl)-2,2-dimethylpropanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H15IN2O2 |
|---|
| Molecular Weight | 334.15300 |
|---|
| Exact Mass | 334.01800 |
|---|
| PSA | 51.22000 |
|---|
| LogP | 2.75240 |
|---|
| InChIKey | WLRFICVEMCFVMF-UHFFFAOYSA-N |
|---|
| SMILES | COc1nccc(I)c1NC(=O)C(C)(C)C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| A-6328 |
| 4-iodo-2-methoxy-3-pivaloylaminopyridine |
| N-(4-Iodo-2-methoxypyridin-3-yl)pivalamide |
| 2,2-dimethyl-N-(4-iodo-2-methoxy-3-pyridyl)propanamide |
| Propanamide, N-(4-iodo-2-methoxy-3-pyridinyl)-2,2-dimethyl- |
