Introduction：Basic information about CAS 13700-78-2|Diethyl2,6-bis(methylthio)-4-oxo-4H-thiopyran-3,5-dicarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diethyl2,6-bis(methylthio)-4-oxo-4H-thiopyran-3,5-dicarboxylate |
|---|
| CAS Number | 13700-78-2 | Molecular Weight | 348.45800 |
|---|
| Density | 1.36g/cm3 | Boiling Point | 459.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H16O5S3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 225.1ºC |
|---|
Names
| Name | diethyl 2,6-bis(methylsulfanyl)-4-oxothiopyran-3,5-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.36g/cm3 |
|---|
| Boiling Point | 459.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H16O5S3 |
|---|
| Molecular Weight | 348.45800 |
|---|
| Flash Point | 225.1ºC |
|---|
| Exact Mass | 348.01600 |
|---|
| PSA | 148.51000 |
|---|
| LogP | 2.90550 |
|---|
| Vapour Pressure | 1.26E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | GLHPGDBPBXGJTA-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1c(SC)sc(SC)c(C(=O)OCC)c1=O |
|---|
Synonyms
| 2,6-bis-methylsulfanyl-4-oxo-4H-thiopyran-3,5-dicarboxylic acid diethyl ester |
| 2,6-Bis-methylmercapto-4-oxo-4H-thiopyran-3,5-dicarbonsaeure-diaethylester |
| 4H-Thiopyran-3,5-dicarboxylicacid,2,6-bis(methylthio)-4-oxo-,3,5-diethyl ester |
| Diethyl 2,6-bis(methylthio)-4-oxo-4H-thiopyran-3,5-dicarboxylate |
