Introduction：Basic information about CAS 168167-42-8|4-DesMethoxypropoxyl-4-chloro Rabeprazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-DesMethoxypropoxyl-4-chloro Rabeprazole |
|---|
| CAS Number | 168167-42-8 | Molecular Weight | 305.783 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 564.1±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12ClN3OS | Melting Point | 128-130ºC |
|---|
| MSDS | / | Flash Point | 295.0±32.9 °C |
|---|
Names
| Name | 2-[(4-chloro-3-methylpyridin-2-yl)methylsulfinyl]-1H-benzimidazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 564.1±60.0 °C at 760 mmHg |
|---|
| Melting Point | 128-130ºC |
|---|
| Molecular Formula | C14H12ClN3OS |
|---|
| Molecular Weight | 305.783 |
|---|
| Flash Point | 295.0±32.9 °C |
|---|
| Exact Mass | 305.038971 |
|---|
| PSA | 77.85000 |
|---|
| LogP | 1.97 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.734 |
|---|
| InChIKey | RAPCQINSRSZSKF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(Cl)ccnc1CS(=O)c1nc2ccccc2[nH]1 |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 4-Desmethoxypropoxyl-4-chloro Rabeprazole |
| 1H-Benzimidazole, 2-[[(4-chloro-3-methyl-2-pyridinyl)methyl]sulfinyl]- |
| 2-[[(4-Chloro-3-methyl-2-pyridinyl)methyl]sulfinyl]-1H-benzimidazole |
| UNII:2YP19K112N |
| 2-{[(4-Chloro-3-methyl-2-pyridinyl)methyl]sulfinyl}-1H-benzimidazole |
| 2-[[(4-CHLORO-3-METHYL-PYRIDIN-2-YL)METHYL]SULFINYL]-1H-BENZO[D]IMIDAZOLE |
| 2-{[(4-Chloro-3-methylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole |
| Lansoprazole Impurity 6 |
