Introduction：Basic information about CAS 161558-45-8|4-[(4-Chlorophenyl)-2-pyridylmethoxy]piperidine p-nitrobenzoic acid salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(4-Chlorophenyl)-2-pyridylmethoxy]piperidine p-nitrobenzoic acid salt |
|---|
| CAS Number | 161558-45-8 | Molecular Weight | 469.918 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C24H24ClN3O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-[(4-chlorophenyl)-piperidin-4-yloxymethyl]pyridine,4-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C24H24ClN3O5 |
|---|
| Molecular Weight | 469.918 |
|---|
| Exact Mass | 469.140442 |
|---|
| PSA | 117.27000 |
|---|
| LogP | 5.73800 |
|---|
| InChIKey | UQSUJCNJGVBZCU-UHFFFAOYSA-N |
|---|
| SMILES | Clc1ccc(C(OC2CCNCC2)c2ccccn2)cc1.O=C(O)c1ccc([N+](=O)[O-])cc1 |
|---|
Synonyms
| 4-Nitrobenzoic acid - 2-[(4-chlorophenyl)(4-piperidinyloxy)methyl]pyridine (1:1) |
| 2-((4-Chlorophenyl)(piperidin-4-yloxy)methyl)pyridine 4-nitrobenzoate |
| Benzoic acid, 4-nitro-, compd. with 2-[(4-chlorophenyl)(4-piperidinyloxy)methyl]pyridine (1:1) |
