Introduction:Basic information about CAS 137088-51-8|1-(tert-butoxycarbonyl)-2-indolinecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(tert-butoxycarbonyl)-2-indolinecarboxylic acid |
|---|
| CAS Number | 137088-51-8 | Molecular Weight | 263.289 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 411.6±44.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H17NO4 | Melting Point | 121-122ºC |
|---|
| MSDS | / | Flash Point | 202.7±28.4 °C |
|---|
Names
| Name | 1-(tert-butoxycarbonyl)-2-indolinecarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 411.6±44.0 °C at 760 mmHg |
|---|
| Melting Point | 121-122ºC |
|---|
| Molecular Formula | C14H17NO4 |
|---|
| Molecular Weight | 263.289 |
|---|
| Flash Point | 202.7±28.4 °C |
|---|
| Exact Mass | 263.115753 |
|---|
| PSA | 66.84000 |
|---|
| LogP | 2.92 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | QONNUMLEACJFME-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1c2ccccc2CC1C(=O)O |
|---|
Synonyms
| 1-(tert-butoxycarbonyl)-2-indolinecarboxylic acid |
| 1H-Indole-1,2-dicarboxylic acid, 2,3-dihydro-, 1-(1,1-dimethylethyl) ester |
| N-Boc-1H-indole |
| tert-Butyl 1H-indole-1-carboxylate |
| 1-boc-indole |
| 1-Boc-indoline-2-carboxylic acid |
| 1-tert-butoxycarbonylindole |
| tert-butyl N-indolecarboxylate |
| 1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-indolinecarboxylic acid |
| N-Boc-indoline-2-carboxylic acid |
| 1-t-butoxycarbonyl-2,3-dihydroindole-2-carboxylic acid |
| N-tert-butoxycarbonylindoline-2-carboxylate |
| N-Boc-indole |
| indole-1-carboxylic acid tert-butyl ester |
| tert-Butyl 1-indolecarboxylate |