Introduction：Basic information about CAS 137932-77-5|Ethyl 4-hydroxy-8-methoxy-5-methyl-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-hydroxy-8-methoxy-5-methyl-2-naphthoate |
|---|
| CAS Number | 137932-77-5 | Molecular Weight | 260.28500 |
|---|
| Density | 1.201g/cm3 | Boiling Point | 449.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.4ºC |
|---|
Names
| Name | Ethyl 4-hydroxy-8-methoxy-5-methyl-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.201g/cm3 |
|---|
| Boiling Point | 449.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16O4 |
|---|
| Molecular Weight | 260.28500 |
|---|
| Flash Point | 169.4ºC |
|---|
| Exact Mass | 260.10500 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 3.03910 |
|---|
| Vapour Pressure | 1.04E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | GVOBJKJXYACWHR-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(O)c2c(C)ccc(OC)c2c1 |
|---|
