Introduction：Basic information about CAS 25215-62-7|(Z)-4-butoxy-4-oxobut-2-enoic acid,styrene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (Z)-4-butoxy-4-oxobut-2-enoic acid,styrene |
|---|
| CAS Number | 25215-62-7 | Molecular Weight | 276.32800 |
|---|
| Density | / | Boiling Point | 289.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H20O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 113.9ºC |
|---|
Names
| Name | (Z)-4-butoxy-4-oxobut-2-enoic acid,styrene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 289.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H20O4 |
|---|
| Molecular Weight | 276.32800 |
|---|
| Flash Point | 113.9ºC |
|---|
| Exact Mass | 276.13600 |
|---|
| PSA | 63.60000 |
|---|
| LogP | 3.30010 |
|---|
| InChIKey | AAFCVNRTKWSHAI-MKWAYWHRSA-N |
|---|
| SMILES | C=Cc1ccccc1.CCCCOC(=O)C=CC(=O)O |
|---|
Synonyms
| 2-Butenedioic acid (2Z)-,1-butyl ester,polymer with ethenylbenzene |
| 2-Butenedioic acid (2Z)-,monobutyl ester,polymer with ethenylbenzene |
| 2-Butenedioic acid (Z)-,monobutyl ester,polymer with ethenylbenzene |
| Butyl maleate,styrene polymer |
