Introduction：Basic information about CAS 130636-60-1|4-(4-nitrophenethyl)piperazine-1-carboxylic acid tert butyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-nitrophenethyl)piperazine-1-carboxylic acid tert butyl ester |
|---|
| CAS Number | 130636-60-1 | Molecular Weight | 335.39800 |
|---|
| Density | 1.173g/cm3 | Boiling Point | 455.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H25N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.3ºC |
|---|
Names
| Name | tert-butyl 4-[2-(4-nitrophenyl)ethyl]piperazine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.173g/cm3 |
|---|
| Boiling Point | 455.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H25N3O4 |
|---|
| Molecular Weight | 335.39800 |
|---|
| Flash Point | 229.3ºC |
|---|
| Exact Mass | 335.18500 |
|---|
| PSA | 78.60000 |
|---|
| LogP | 3.08900 |
|---|
| Vapour Pressure | 1.74E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | RBEXASHZNSBASY-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCN(CCc2ccc([N+](=O)[O-])cc2)CC1 |
|---|
Synonyms
| 1-[2-(4-nitrophenyl)ethyl]-4-tert-butyloxycarbonylpiperazine |
| 4-(4-nitrophenethyl)piperazine-1-carboxylic acid tert butyl ester |
| 4-[2-(4-nitro-phenyl)-ethyl]-piperazine-1-carboxylic acid tert-butyl ester |
