Introduction：Basic information about CAS 36393-42-7|4'-Methylbiphenyl-4-carbaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4'-Methylbiphenyl-4-carbaldehyde |
|---|
| CAS Number | 36393-42-7 | Molecular Weight | 196.24400 |
|---|
| Density | 1.074g/cm3 | Boiling Point | 338.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12O | Melting Point | 104-108ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 184.8ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-(4-methylphenyl)benzaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.074g/cm3 |
|---|
| Boiling Point | 338.3ºC at 760 mmHg |
|---|
| Melting Point | 104-108ºC |
|---|
| Molecular Formula | C14H12O |
|---|
| Molecular Weight | 196.24400 |
|---|
| Flash Point | 184.8ºC |
|---|
| Exact Mass | 196.08900 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.47450 |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | BCINBWXQYBLSKO-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(-c2ccc(C=O)cc2)cc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn;N |
|---|
| Risk Phrases | R22;R51/53 |
|---|
| Safety Phrases | S61 |
|---|
| RIDADR | UN 3077 |
|---|
| WGK Germany | 2 |
|---|
| HS Code | 2912299000 |
|---|
Customs
| HS Code | 2912299000 |
|---|
| Summary | 2912299000. other cyclic aldehydes without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| MFCD02258938 |
| 4'-methyl-biphenyl-4-carbaldehyde |
| 4-formyl-4'-methylbiphenyl |
| 4'-Methyl-4-formylbiphenyl |
| 4-(4-Methylphenyl)benzaldehyde |
| 4'-methyl-biphenyl-4-carboxaldehyde |
| 4'-methyl-4-biphenylcarboxaldehyde |
| 4′-Methylbiphenyl-4-carboxaldehyde |
