Introduction：Basic information about CAS 1372527-39-3|Dodoviscin H, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dodoviscin H |
|---|
| CAS Number | 1372527-39-3 | Molecular Weight | 454.512 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 692.0±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H30O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233.1±25.0 °C |
|---|
Names
| Name | Dodoviscin H |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 692.0±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H30O7 |
|---|
| Molecular Weight | 454.512 |
|---|
| Flash Point | 233.1±25.0 °C |
|---|
| Exact Mass | 454.199158 |
|---|
| PSA | 120.36000 |
|---|
| LogP | 4.84 |
|---|
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | DJUDTARIJQVMAT-UHFFFAOYSA-N |
|---|
| SMILES | COc1c(-c2cc(CC=C(C)C)c(O)c(CCC(C)CO)c2)oc2cc(O)cc(O)c2c1=O |
|---|
Synonyms
| 5,7-Dihydroxy-2-[4-hydroxy-3-(4-hydroxy-3-methylbutyl)-5-(3-methyl-2-buten-1-yl)phenyl]-3-methoxy-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-[4-hydroxy-3-(4-hydroxy-3-methylbutyl)-5-(3-methyl-2-buten-1-yl)phenyl]-3-methoxy- |
