Introduction:Basic information about CAS 331976-99-9|1-(1H-Indol-3-ylmethyl)-3-piperidinol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(1H-Indol-3-ylmethyl)-3-piperidinol |
|---|
| CAS Number | 331976-99-9 | Molecular Weight | 230.30600 |
|---|
| Density | 1.243 g/cm3 | Boiling Point | 417.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H18N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-(1H-indol-3-ylmethyl)piperidin-3-ol |
|---|
Chemical & Physical Properties
| Density | 1.243 g/cm3 |
|---|
| Boiling Point | 417.3ºC at 760 mmHg |
|---|
| Molecular Formula | C14H18N2O |
|---|
| Molecular Weight | 230.30600 |
|---|
| Exact Mass | 230.14200 |
|---|
| PSA | 39.26000 |
|---|
| LogP | 2.06250 |
|---|
| Index of Refraction | 1.675 |
|---|
| InChIKey | VWPCDDTXLWVHRD-UHFFFAOYSA-N |
|---|
| SMILES | OC1CCCN(Cc2c[nH]c3ccccc23)C1 |
|---|