Introduction：Basic information about CAS 4474-24-2|acid blue 80, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | acid blue 80 |
|---|
| CAS Number | 4474-24-2 | Molecular Weight | 678.683 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C32H28N2Na2O8S2 | Melting Point | 300ºC |
|---|
| MSDS | ChineseUSA | Flash Point | >300ºC(lit.) |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | acid blue 80 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 300ºC |
|---|
| Molecular Formula | C32H28N2Na2O8S2 |
|---|
| Molecular Weight | 678.683 |
|---|
| Flash Point | >300ºC(lit.) |
|---|
| Exact Mass | 678.108276 |
|---|
| PSA | 189.36000 |
|---|
| LogP | 7.91540 |
|---|
| Index of Refraction | 1.679 |
|---|
| InChIKey | UHXQPQCJDDSMCB-UHFFFAOYSA-L |
|---|
| SMILES | Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1Nc1ccc(Nc2c(C)cc(C)c(S(=O)(=O)[O-])c2C)c2c1C(=O)c1ccccc1C2=O.[Na+].[Na+] |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36 |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 2 |
|---|
| RTECS | DB6083000 |
|---|
Synonyms
| Vicoacid Blue 80 |
| coomassieblueb |
| sodium 3,3'-(9,10-dioxoanthracene-1,4-diyldiimino)bis(2,4,6-trimethylbenzenesulphonate) |
| nylosanbluec-l |
| EINECS 224-748-4 |
| MillingFastBlueSBL |
| endanilblueb |
| Disodium 3,3'-[(9,10-dioxo-9,10-dihydroanthracene-1,4-diyl)diimino]bis(2,4,6-trimethylbenzenesulfonate) |
| MFCD00001192 |
| Benzenesulfonic acid, 3,3'-[(9,10-dihydro-9,10-dioxo-1,4-anthracenediyl)diimino]bis[2,4,6-trimethyl-, sodium salt (1:2) |
| LeatherBlueRAW |
| c-wrblue10 |
| C.I.Acidblue80 |
