Introduction：Basic information about CAS 130339-07-0|diflumetorim, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | diflumetorim |
|---|
| CAS Number | 130339-07-0 | Molecular Weight | 327.75700 |
|---|
| Density | 1.294g/cm3 | Boiling Point | 431.796ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16ClF2N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 214.943ºC |
|---|
Names
| Name | diflumetorim |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.294g/cm3 |
|---|
| Boiling Point | 431.796ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16ClF2N3O |
|---|
| Molecular Weight | 327.75700 |
|---|
| Flash Point | 214.943ºC |
|---|
| Exact Mass | 327.09500 |
|---|
| PSA | 47.04000 |
|---|
| LogP | 4.67600 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | NEKULYKCZPJMMJ-UHFFFAOYSA-N |
|---|
| SMILES | CCC(Nc1ncnc(C)c1Cl)c1ccc(OC(F)F)cc1 |
|---|
Synonyms
| 5-chloro-N-[1-[4-(difluoromethoxy)phenyl]propyl]-6-methyl-4-pyrimidinamine |
| Diflumetorim [ISO] |
| (RS)-5-chloro-N-{1-[4-(difluoromethoxy)phenyl]propyl}-6-methylpyrimidin-4-ylamine |
| Diflumetorim |
| 5-chloro-N-[1-[4-(difluoromethoxy)phenyl]propyl]-6-methylpyrimidin-4-amine |
| rac-5-chloro-N-{(1R)-1-[4-(difluoromethoxy)phenyl]propyl}-6-methylpyrimidin-4-amine |
