Introduction：Basic information about CAS 13694-84-3|tetrahydrofuran-3-yl 4-methylbenzenesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tetrahydrofuran-3-yl 4-methylbenzenesulfonate |
|---|
| CAS Number | 13694-84-3 | Molecular Weight | 226.29200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H14O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (s)-3-tosyltetrahydrofuran |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H14O3S |
|---|
| Molecular Weight | 226.29200 |
|---|
| Exact Mass | 226.06600 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 2.63840 |
|---|
| InChIKey | LSOCCBCGJYSBKS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)C2CCOC2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 3-[(4-methylphenyl)sulphonyloxy]-tetrahydrofuran |
| (1-oxo-2,3,4,9-tetrahydro-1h-carbazol-3-yl)methyl 4-methylbenzenesulfonate |
| p-toluenesulphonate |
| tetrahydrofuran-3-yl 4-methylbenzenesulfonate |
| 3-tosyloxytetrahydrofuran |
| 3-toluene-4-sulfonyloxymethyl-2,3,4,9-tetrahydro-carbazol-1-one |
| 3-Tosyloxymethyl-1-oxo-1,2,3,4-tetrahydro-carbazol |
| 3-tetrahydrofuranyl tosylate |
| tetrahydro-3-furanyl tosylate |
| toluene-4-sulfonic acid tetrahydrofuran-3-yl ester |
