Introduction:Basic information about CAS 131-61-3|Phenol,2,3,4,6-tetrachloro-, sodium salt (1:1), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenol,2,3,4,6-tetrachloro-, sodium salt (1:1) |
|---|
| CAS Number | 131-61-3 | Molecular Weight | 253.87300 |
|---|
| Density | 1.709g/cm3 | Boiling Point | 267.7ºC at 760mmHg |
|---|
| Molecular Formula | C6HCl4NaO | Melting Point | 70ºC |
|---|
| MSDS | / | Flash Point | 115.7ºC |
|---|
Names
| Name | 2,3,4,6-tetrachlorophenol sodium salt |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.709g/cm3 |
|---|
| Boiling Point | 267.7ºC at 760mmHg |
|---|
| Melting Point | 70ºC |
|---|
| Molecular Formula | C6HCl4NaO |
|---|
| Molecular Weight | 253.87300 |
|---|
| Flash Point | 115.7ºC |
|---|
| Exact Mass | 251.86800 |
|---|
| PSA | 23.06000 |
|---|
| LogP | 4.44400 |
|---|
| InChIKey | YLFFQZKUOUYUFG-UHFFFAOYSA-M |
|---|
| SMILES | [Na+].[O-]c1c(Cl)cc(Cl)c(Cl)c1Cl |
|---|
Safety Information
Customs
| HS Code | 2908199090 |
|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
|---|
Synonyms
| 2,3,3′,4,4′,5-HEXACHLOROBIPHENYL-2′,6′,6′-D3 |
| Tetrachlorophenolsodiumsalt |
| 2,3,4,6-tetrachloro-phenol,sodium-compound |
| MFCD00019980 |
| Sodium 2,3,4,6-tetrachlorophenolate |
| 2,3,4,6-Tetrachlor-phenol,Natrium-Verbindung |
| 2,3,4,6-sodium tetrachlorophenate |
| sodium 2,3,4,6-tetrachlorophenate |
| SODIUMTETRACHLOROPHENOL |