Introduction：Basic information about CAS 13653-84-4|Rink Amide Resin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Rink Amide Resin |
|---|
| CAS Number | 13653-84-4 | Molecular Weight | 318.32300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C20H14O4 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | 4-[4-(4-carboxyphenyl)phenyl]benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C20H14O4 |
|---|
| Molecular Weight | 318.32300 |
|---|
| Exact Mass | 318.08900 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 4.41700 |
|---|
| InChIKey | FZTIWOBQQYPTCJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(-c2ccc(-c3ccc(C(=O)O)cc3)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 1,4-Bis(4-carboxyphenyl)benzene |
| p-Terphenylen-4-4''-dicarbonsaeure |
| 4,4''-Terphenyl-dicarbonsaeure |
| 4.4''-Dicarboxy-p-terphenyl |
| Rink Amide Resin |
| 4,4'-terphenyldicarboxylic acid |
