Introduction:Basic information about CAS 135139-00-3|(S)-xyl-BINAP, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-xyl-BINAP |
|---|
| CAS Number | 135139-00-3 | Molecular Weight | 734.885 |
|---|
| Density | / | Boiling Point | 825.3±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C52H48P2 | Melting Point | 189-193ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 485.3±40.6 °C |
|---|
Names
| Name | (S)-(-)-2,2'-Bis[di(3,5-xylyl)phosphino]-1,1'-binaphthyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 825.3±65.0 °C at 760 mmHg |
|---|
| Melting Point | 189-193ºC |
|---|
| Molecular Formula | C52H48P2 |
|---|
| Molecular Weight | 734.885 |
|---|
| Flash Point | 485.3±40.6 °C |
|---|
| Exact Mass | 734.323120 |
|---|
| PSA | 27.18000 |
|---|
| LogP | 17.06 |
|---|
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
|---|
| InChIKey | MXGXXBYVDMVJAO-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)cc(P(c2cc(C)cc(C)c2)c2ccc3ccccc3c2-c2c(P(c3cc(C)cc(C)c3)c3cc(C)cc(C)c3)ccc3ccccc23)c1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Xylbinap |
| (S)-DM-BINAP |
| (S)-(-)-2,2′-Bis(di-3,5-xylylphosphino)-1,1′-binaphthyl |
| (S)-xylyl-BINAP |
| Phosphine, 1,1'-[1,1'-binaphthalene]-2,2'-diylbis[1,1-bis(3,5-dimethylphenyl)- |
| (S)-(-)-XylBINAP |
| (S)-xyl-BINAP |
| RAC-XYLYL-BINAP |
| 1,1'-Binaphthalene-2,2'-diylbis[bis(3,5-dimethylphenyl)phosphine] |
| MFCD01630821 |
| (S)-(-)-2,2'-Bis(di-3,5-xylylphosphino)-1,1'-binaphthyl |