Introduction：Basic information about CAS 58765-21-2|Ciclotizolam, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ciclotizolam |
|---|
| CAS Number | 58765-21-2 | Molecular Weight | 461.80600 |
|---|
| Density | 1.69g/cm3 | Boiling Point | 615.6ºC at 760 mmHg |
|---|
| Molecular Formula | C20H18BrClN4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 326.1ºC |
|---|
Names
| Name | Ciclotizolam |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.69g/cm3 |
|---|
| Boiling Point | 615.6ºC at 760 mmHg |
|---|
| Molecular Formula | C20H18BrClN4S |
|---|
| Molecular Weight | 461.80600 |
|---|
| Flash Point | 326.1ºC |
|---|
| Exact Mass | 460.01200 |
|---|
| PSA | 71.31000 |
|---|
| LogP | 5.57900 |
|---|
| Index of Refraction | 1.784 |
|---|
| InChIKey | ZOSHXIXUCKESEG-UHFFFAOYSA-N |
|---|
| SMILES | Clc1ccccc1C1=NCc2nnc(C3CCCCC3)n2-c2sc(Br)cc21 |
|---|
Synonyms
| ciclotiazolam |
| 2-Bromo-4-(o-chlorophenyl)-9-cyclohexyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine |
| 2-bromo-4-(2-chloro-phenyl)-9-cyclohexyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine |
| We-973BS |
