Introduction：Basic information about CAS 137-76-8|Cetotiamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cetotiamine |
|---|
| CAS Number | 137-76-8 | Molecular Weight | 426.48700 |
|---|
| Density | 1.277g/cm3 | Boiling Point | 610.2ºC at 760mmHg |
|---|
| Molecular Formula | C18H26N4O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 322.8ºC |
|---|
Names
| Name | ethyl [(Z)-2-[(4-amino-2-methylpyrimidin-5-yl)methyl-formylamino]-5-ethoxycarbonyloxypent-2-en-3-yl]sulfanylformate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.277g/cm3 |
|---|
| Boiling Point | 610.2ºC at 760mmHg |
|---|
| Molecular Formula | C18H26N4O6S |
|---|
| Molecular Weight | 426.48700 |
|---|
| Flash Point | 322.8ºC |
|---|
| Exact Mass | 426.15700 |
|---|
| PSA | 159.24000 |
|---|
| LogP | 4.22710 |
|---|
| Vapour Pressure | 7.88E-15mmHg at 25°C |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | YBROOZNJUDHTGE-QINSGFPZSA-N |
|---|
| SMILES | CCOC(=O)OCCC(SC(=O)OCC)=C(C)N(C=O)Cc1cnc(C)nc1N |
|---|
Synonyms
| O,S-Dicarbethoxythiamine |
| Cetotiamine |
| Cetotiamina |
| O,S-Bis-aethoxycarbonyl-thiamin |
| O,S-Bis-(ethoxycarbonyl)-thiamin |
| Cetotiamine HCl |
| DCET |
| Cetotiaminum |
| Dicethiamin |
| N-(4-amino-2-methyl-pyrimidin-5-ylmethyl)-N-(4-ethoxycarbonyloxy-2-ethoxycarbonylsulfanyl-1-methyl-but-1-enyl)-formamide |
| Cetotiaminum [INN-Latin] |
