Introduction：Basic information about CAS 77862-92-1|Falipamil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Falipamil |
|---|
| CAS Number | 77862-92-1 | Molecular Weight | 428.52100 |
|---|
| Density | 1.146g/cm3 | Boiling Point | 597.1ºC at 760 mmHg |
|---|
| Molecular Formula | C24H32N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 314.9ºC |
|---|
Names
| Name | 2-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propyl]-5,6-dimethoxy-3H-isoindol-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.146g/cm3 |
|---|
| Boiling Point | 597.1ºC at 760 mmHg |
|---|
| Molecular Formula | C24H32N2O5 |
|---|
| Molecular Weight | 428.52100 |
|---|
| Flash Point | 314.9ºC |
|---|
| Exact Mass | 428.23100 |
|---|
| PSA | 60.47000 |
|---|
| LogP | 3.17930 |
|---|
| Index of Refraction | 1.557 |
|---|
| InChIKey | UUMGNNQOCVDZDG-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(CCN(C)CCCN2Cc3cc(OC)c(OC)cc3C2=O)cc1OC |
|---|
Synonyms
| AQ-A-39 |
| 1H-Isoindol-1-one,2-(3-((2-(3,4-dimethoxyphenyl)ethyl)methylamino)propyl)-2,3-dihydro-5,6-dimethoxy |
| 5,6-Dimethoxy-2-N-(3-<2-(3,4-dimethoxy)-phenylethyl-methyl-amino>-propyl)-phthalimidin |
| Falipamilum |
| Falipamil |
| 2-(3-((3,4-Dimethoxyphenetyl)methylamino)propyl)-5,6-dimethoxyphthalimidine |
| 2-(3-((2-(3,4-dimethoxyphenyl)ethyl)methylamino)propyl)-2,3-dihydro-5,6-dimethoxy-1h-isoindol-1-one |
| AQA 39Cl |
| 2,3-dihydro-5,6-dimethoxy-2-{3-[N-(3,4-dimethoxyphenethyl-2)methylamino]propyl}-1H-isoindolone |
| Falipamilum [INN-Latin] |
