Introduction：Basic information about CAS 82239-52-9|Moxiraprine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Moxiraprine |
|---|
| CAS Number | 82239-52-9 | Molecular Weight | 314.38200 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 451.4ºC at 760 mmHg |
|---|
| Molecular Formula | C17H22N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.8ºC |
|---|
Names
| Name | 4-[4-methyl-3-(2-morpholin-4-ylethylamino)-1H-pyridazin-6-ylidene]cyclohexa-2,5-dien-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 451.4ºC at 760 mmHg |
|---|
| Molecular Formula | C17H22N4O2 |
|---|
| Molecular Weight | 314.38200 |
|---|
| Flash Point | 226.8ºC |
|---|
| Exact Mass | 314.17400 |
|---|
| PSA | 70.51000 |
|---|
| LogP | 1.91260 |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | ADRHYFBXMFKHDO-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(-c2ccc(O)cc2)nnc1NCCN1CCOCC1 |
|---|
Synonyms
| Moxiraprina |
| Moxiraprine |
| Moxiraprina [INN-Spanish] |
| Moxiraprinum |
| p-(5-Methyl-6-((2-morpholinoethyl)amino)-3-pyridazinyl)phenol |
| Moxiraprinum [INN-Latin] |
