Introduction：Basic information about CAS 16985-03-8|Nonabine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nonabine |
|---|
| CAS Number | 16985-03-8 | Molecular Weight | 379.53500 |
|---|
| Density | 1.047g/cm3 | Boiling Point | 504.6ºC at 760mmHg |
|---|
| Molecular Formula | C25H33NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 259ºC |
|---|
Names
| Name | 2,2-dimethyl-7-(3-methyloctan-2-yl)-4-pyridin-4-ylchromen-5-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.047g/cm3 |
|---|
| Boiling Point | 504.6ºC at 760mmHg |
|---|
| Molecular Formula | C25H33NO2 |
|---|
| Molecular Weight | 379.53500 |
|---|
| Flash Point | 259ºC |
|---|
| Exact Mass | 379.25100 |
|---|
| PSA | 42.35000 |
|---|
| LogP | 6.70980 |
|---|
| Vapour Pressure | 8.33E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.549 |
|---|
| InChIKey | YHUDSHIRWOVVCV-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCC(C)C(C)c1cc(O)c2c(c1)OC(C)(C)C=C2c1ccncc1 |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Nonabinum |
| 2,2-Dimethyl-7-(3-methyl-2-octyl)-4-(4-pyridyl)-2H-chromen-5-ol |
| Nonabino [INN-Spanish] |
| 2,2-Dimethyl-5-hydroxy-7-(3-methyl-2-octyl)-4-(4-pyridyl)-2H-1-benzopyran |
| 2-Methyl-4-<pyridyl-(4)>-5-hydroxy-6-<3-methyloctyl-(2)>-2H-chromenyl-(2)-oxymagnesiumbromid |
| 2,2-dimethyl-7-(3-methyloctan-2-yl)-4-(pyridin-4-yl)-2h-chromen-5-ol |
| Nonabine |
| 7-(1,2-dimethyl-heptyl)-2,2-dimethyl-4-pyridin-4-yl-2H-chromen-5-ol |
| Nonabino |
| Nonabinum [INN-Latin] |
