Introduction：Basic information about CAS 13005-35-1|copper (ii) gluconate, min. 98, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | copper (ii) gluconate, min. 98 |
|---|
| CAS Number | 13005-35-1 | Molecular Weight | 453.84100 |
|---|
| Density | 1.763g/cm3 | Boiling Point | 673.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H22CuO14 | Melting Point | 131ºC |
|---|
| MSDS | / | Flash Point | 375.2ºC |
|---|
Names
| Name | copper,2,3,4,5,6-pentahydroxyhexanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.763g/cm3 |
|---|
| Boiling Point | 673.6ºC at 760mmHg |
|---|
| Melting Point | 131ºC |
|---|
| Molecular Formula | C12H22CuO14 |
|---|
| Molecular Weight | 453.84100 |
|---|
| Flash Point | 375.2ºC |
|---|
| Exact Mass | 453.03100 |
|---|
| PSA | 282.56000 |
|---|
| Appearance of Characters | Powder | blue |
|---|
| Vapour Pressure | 4.95E-21mmHg at 25°C |
|---|
| InChIKey | OCUCCJIRFHNWBP-UHFFFAOYSA-L |
|---|
| SMILES | O=C([O-])C(O)C(O)C(O)C(O)CO.O=C([O-])C(O)C(O)C(O)C(O)CO.[Cu+2] |
|---|
Safety Information
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| EINECS 235-844-0 |
| CUPRIC GLUCONATE |
| Chelates of copper gluconate |
| Cupric gluconate monohydrate |
| copper gluconate |
| Copper D-gluconate |
| Copper di-D-gluconate |
