Introduction:Basic information about CAS 610277-19-5|7-Bromo-2-methylquinoline-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Bromo-2-methylquinoline-3-carboxylic acid |
|---|
| CAS Number | 610277-19-5 | Molecular Weight | 266.09100 |
|---|
| Density | 1.644g/cm3 | Boiling Point | 394.8ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8BrNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 192.6ºC |
|---|
Names
| Name | 7-Bromo-2-methylquinoline-3-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.644g/cm3 |
|---|
| Boiling Point | 394.8ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8BrNO2 |
|---|
| Molecular Weight | 266.09100 |
|---|
| Flash Point | 192.6ºC |
|---|
| Exact Mass | 264.97400 |
|---|
| PSA | 50.19000 |
|---|
| LogP | 3.00390 |
|---|
| Index of Refraction | 1.687 |
|---|
| InChIKey | MNECBPMUKCWRSJ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc2cc(Br)ccc2cc1C(=O)O |
|---|