Introduction：Basic information about CAS 134150-51-9|FMOC-TYR(PO3BZL2)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | FMOC-TYR(PO3BZL2)-OH |
|---|
| CAS Number | 134150-51-9 | Molecular Weight | 663.65200 |
|---|
| Density | 1.321g/cm3 | Boiling Point | 818.9ºC at 760 mmHg |
|---|
| Molecular Formula | C38H34NO8P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 449.1ºC |
|---|
Names
| Name | (2S)-3-[4-bis(phenylmethoxy)phosphoryloxyphenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.321g/cm3 |
|---|
| Boiling Point | 818.9ºC at 760 mmHg |
|---|
| Molecular Formula | C38H34NO8P |
|---|
| Molecular Weight | 663.65200 |
|---|
| Flash Point | 449.1ºC |
|---|
| Exact Mass | 663.20200 |
|---|
| PSA | 130.20000 |
|---|
| LogP | 8.53240 |
|---|
| Vapour Pressure | 2.25E-28mmHg at 25°C |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | JSTYRDUOBZALLV-BHVANESWSA-N |
|---|
| SMILES | O=C(NC(Cc1ccc(OP(=O)(OCc2ccccc2)OCc2ccccc2)cc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
|---|
| Storage condition | -20°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| O-[bis(benzyloxy)phosphoryl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-tyrosine |
| Fmoc-pTyr-OH |
| Fmoc-Tyr(OPO(OBn)2)-OH |
| Fmoc-Tyr(PO3Bzl2)-OH |
| N2-<<(9H-Fluoren-9-yl)methoxy>carbonyl>-O4-<bis(benzyloxy)phosphoryl>-L-tyrosine |
| N|A-Fmoc-O-[bis(benzyloxy)phosphoryl]-L-tyrosine |
