Introduction：Basic information about CAS 163260-73-9|4-(1,4-DIOXASPIRO[4,5]DEC-8-YL)-BENZOIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(1,4-DIOXASPIRO[4,5]DEC-8-YL)-BENZOIC ACID |
|---|
| CAS Number | 163260-73-9 | Molecular Weight | 262.30100 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 436.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H18O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 164ºC |
|---|
Names
| Name | 4-(1,4-dioxaspiro[4.5]decan-8-yl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 436.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H18O4 |
|---|
| Molecular Weight | 262.30100 |
|---|
| Flash Point | 164ºC |
|---|
| Exact Mass | 262.12100 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 2.78550 |
|---|
| Vapour Pressure | 2.23E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | RXTBZHWAFRMKNN-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(C2CCC3(CC2)OCCO3)cc1 |
|---|
Synonyms
| 4-(1,4-Dioxaspiro[4,5]dec-8-yl)-benzoic acid |
| 4-(1,4-Dioxaspiro[4.5]decan-8-yl)benzoicacid |
| Benzoic acid,4-(1,4-dioxaspiro[4.5]dec-8-yl) |
