Introduction：Basic information about CAS 31184-53-9|1H-Benz[g]indazol-7-ol,4,5-dihydro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Benz[g]indazol-7-ol,4,5-dihydro- |
|---|
| CAS Number | 31184-53-9 | Molecular Weight | 186.21000 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 364.5ºC at 760mmHg |
|---|
| Molecular Formula | C11H10N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.4ºC |
|---|
Names
| Name | 1,2,4,5-tetrahydrobenzo[g]indazol-7-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 364.5ºC at 760mmHg |
|---|
| Molecular Formula | C11H10N2O |
|---|
| Molecular Weight | 186.21000 |
|---|
| Flash Point | 165.4ºC |
|---|
| Exact Mass | 186.07900 |
|---|
| PSA | 48.91000 |
|---|
| LogP | 1.88090 |
|---|
| Index of Refraction | 1.685 |
|---|
| InChIKey | LOTQTXAXHJARHM-UHFFFAOYSA-N |
|---|
| SMILES | Oc1ccc2c(c1)CCc1cn[nH]c1-2 |
|---|
Synonyms
| Hydroxybenzindazole |
| 4,5-Dihydro-1H-benz<g>indazol-7-ol |
