Introduction：Basic information about CAS 135716-09-5|N-Boc-4-ethyl piperidinecarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Boc-4-ethyl piperidinecarboxylate |
|---|
| CAS Number | 135716-09-5 | Molecular Weight | 271.353 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 339.2±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H25NO4 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 158.9±20.4 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | tert-Butyl 4-(2-ethoxy-2-oxoethyl)piperidine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 339.2±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H25NO4 |
|---|
| Molecular Weight | 271.353 |
|---|
| Flash Point | 158.9±20.4 °C |
|---|
| Exact Mass | 271.178345 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 2.31 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.467 |
|---|
| InChIKey | PQEXLIRUMIRSAL-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CC1CCN(C(=O)OC(C)(C)C)CC1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| ethyl [1-(tert-butoxycarbonyl)piperidin-4-yl]acetate |
| tert-Butyl 4-(2-ethoxy-2-oxoethyl)piperidine-1-carboxylate |
| Ethyl N-BOC-piperidine-4-acetate |
| N-Boc-4-ethyl piperidinecarboxylate |
| 1-BOC-4-(2-ETHOXY-2-OXOETHYL)PIPERIDINE |
| 1-tert-butoxycarbonyl-4-ethoxycarbonylmethylpiperidine |
| ethyl 1-[(1,1-dimethylethoxy)carbonyl]-4-piperidineacetate |
| t-butyl 4-(2-ethoxy-2-oxoethyl)tetrahydropyridine-1(2H)-carboxylate |
| 1-tert-butoxycarbonylpiperidin-4-acetic acid ethyl ester |
| 4-Piperidineacetic acid, 1-[(1,1-dimethylethoxy)carbonyl]-, ethyl ester |
| 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate |
| 4-Ethyl 1-(2-Methyl-2-Propanyl) 1,4-Piperidinedicarboxylate |
| 2-(1-t-Butoxycarbonyl-4-piperidyl)ethanoic acid ethyl ester |
| tert-butyl 4-(2-ethoxy-2-oxoethyl)-1-piperidine carboxylate |
