Introduction：Basic information about CAS 361162-95-0|6-amino-4-(3-chloro-4-fluorophenylamino)-7-ethoxyquinoline-3-carbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-amino-4-(3-chloro-4-fluorophenylamino)-7-ethoxyquinoline-3-carbonitrile |
|---|
| CAS Number | 361162-95-0 | Molecular Weight | 356.78100 |
|---|
| Density | 1.421g/cm3 | Boiling Point | 533.385ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14ClFN4O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 276.382ºC |
|---|
Names
| Name | 6-amino-4-(3-chloro-4-fluoroanilino)-7-ethoxyquinoline-3-carbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.421g/cm3 |
|---|
| Boiling Point | 533.385ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14ClFN4O |
|---|
| Molecular Weight | 356.78100 |
|---|
| Flash Point | 276.382ºC |
|---|
| Exact Mass | 356.08400 |
|---|
| PSA | 87.19000 |
|---|
| LogP | 4.62658 |
|---|
| Index of Refraction | 1.677 |
|---|
| InChIKey | AIQFOGOHLOICRK-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(F)c(Cl)c3)c2cc1N |
|---|
