Introduction：Basic information about CAS 25932-97-2|Ethyl 4-acetoxy-6,8-dimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-acetoxy-6,8-dimethoxy-2-naphthoate |
|---|
| CAS Number | 25932-97-2 | Molecular Weight | 318.32100 |
|---|
| Density | 1.207g/cm3 | Boiling Point | 475.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H18O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 210.5ºC |
|---|
Names
| Name | Ethyl 4-acetoxy-6,8-dimethoxy-2-naphthoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.207g/cm3 |
|---|
| Boiling Point | 475.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H18O6 |
|---|
| Molecular Weight | 318.32100 |
|---|
| Flash Point | 210.5ºC |
|---|
| Exact Mass | 318.11000 |
|---|
| PSA | 71.06000 |
|---|
| LogP | 2.95900 |
|---|
| Vapour Pressure | 3.3E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.559 |
|---|
| InChIKey | YHQUAFBOTWPYTR-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(OC(C)=O)c2cc(OC)cc(OC)c2c1 |
|---|
Synonyms
| 4-Acetoxy-6,8-dimethoxy-2-naphthoesaeureaethylester |
| ethyl 4-acetoxy-6,8-dimethoxynaphthalene-2-carboxylate |
| 4-acetoxy-6,8-dimethoxynaphthalene-2-carboxylic acid ethyl ester |
