Introduction：Basic information about CAS 31206-82-3|6-(Dimethylamino)-4-methoxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-(Dimethylamino)-4-methoxy-2-naphthoic acid |
|---|
| CAS Number | 31206-82-3 | Molecular Weight | 245.27400 |
|---|
| Density | 1.238g/cm3 | Boiling Point | 433.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 216.2ºC |
|---|
Names
| Name | 6-(Dimethylamino)-4-methoxy-2-naphthoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.238g/cm3 |
|---|
| Boiling Point | 433.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15NO3 |
|---|
| Molecular Weight | 245.27400 |
|---|
| Flash Point | 216.2ºC |
|---|
| Exact Mass | 245.10500 |
|---|
| PSA | 49.77000 |
|---|
| LogP | 2.61260 |
|---|
| Index of Refraction | 1.647 |
|---|
| InChIKey | ZEMJPMVEEXRKON-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C(=O)O)cc2ccc(N(C)C)cc12 |
|---|
Synonyms
| Purin-2-ol,6-dimethylamino |
| 6-dimethylamino-3,7-dihydro-purin-2-one |
| 6-Dimethylamino-4-methoxy-2-naphthoesaeure |
| 6-Dimethylamino-4-acetoxy-2-methylnaphthoat |
