Introduction：Basic information about CAS 31222-35-2|4-Acetoxy-6-(dimethylamino)-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Acetoxy-6-(dimethylamino)-2-naphthoic acid |
|---|
| CAS Number | 31222-35-2 | Molecular Weight | 273.28400 |
|---|
| Density | 1.29g/cm3 | Boiling Point | 468.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 237.1ºC |
|---|
Names
| Name | 4-Acetoxy-6-(dimethylamino)-2-naphthoic acid |
|---|
Chemical & Physical Properties
| Density | 1.29g/cm3 |
|---|
| Boiling Point | 468.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15NO4 |
|---|
| Molecular Weight | 273.28400 |
|---|
| Flash Point | 237.1ºC |
|---|
| Exact Mass | 273.10000 |
|---|
| PSA | 66.84000 |
|---|
| LogP | 2.52930 |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | RECVRILPHDWBHW-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1cc(C(=O)O)cc2ccc(N(C)C)cc12 |
|---|
