Introduction：Basic information about CAS 369631-83-4|ethyl 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate |
|---|
| CAS Number | 369631-83-4 | Molecular Weight | 245.27400 |
|---|
| Density | 1.133g/cm3 | Boiling Point | 370.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 177.8ºC |
|---|
Names
| Name | ethyl 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.133g/cm3 |
|---|
| Boiling Point | 370.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15NO3 |
|---|
| Molecular Weight | 245.27400 |
|---|
| Flash Point | 177.8ºC |
|---|
| Exact Mass | 245.10500 |
|---|
| PSA | 52.33000 |
|---|
| LogP | 2.75560 |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | BIYIMMVCHPSMJI-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)Cc1nc(-c2ccccc2)oc1C |
|---|
Synonyms
| I14-9248 |
| 4-Oxazoleacetic acid,5-methyl-2-phenyl-,ethyl ester |
| A6367 |
