Introduction:Basic information about CAS 39622-80-5|2-Bromoisophthalic acid dimethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Bromoisophthalic acid dimethyl ester |
|---|
| CAS Number | 39622-80-5 | Molecular Weight | 273.080 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 313.0±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H9BrO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 143.1±22.3 °C |
|---|
Names
| Name | Dimethyl 2-bromoisophthalate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 313.0±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H9BrO4 |
|---|
| Molecular Weight | 273.080 |
|---|
| Flash Point | 143.1±22.3 °C |
|---|
| Exact Mass | 271.968414 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.38 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | GHPOMFOMBISJGM-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cccc(C(=O)OC)c1Br |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 2-Bromoisophthalic acid dimethyl ester |
| 1,3-Benzenedicarboxylic acid, 2-bromo-, dimethyl ester |
| 2-bromo-isophthalic acid dimethyl ester |
| 2-Brom-citraconsaeure-dimethylester |
| Dimethyl 2-bromoisophthalate |
| methyl 2-bromoisophthalate |
| dimethyl 2-bromo-3-methylbutenedioate |
| cis-2-bromo-3-methylbutenedioic acid dimethyl ester |
| Bromocitraconic-acid-dimethyl-ester |
| 2-Brom-isophthalsaeure-dimethylester |