Introduction:Basic information about CAS 31143-71-2|4-[(2,2,2-trifluoroacetyl)amino]benzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(2,2,2-trifluoroacetyl)amino]benzenesulfonyl chloride |
|---|
| CAS Number | 31143-71-2 | Molecular Weight | 287.64300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H5ClF3NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-[(2,2,2-trifluoroacetyl)amino]benzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C8H5ClF3NO3S |
|---|
| Molecular Weight | 287.64300 |
|---|
| Exact Mass | 286.96300 |
|---|
| PSA | 71.62000 |
|---|
| LogP | 3.26870 |
|---|
| InChIKey | GPOVNGYOABSOFX-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1ccc(S(=O)(=O)Cl)cc1)C(F)(F)F |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-[(trifluoroacetyl)amino]benzenesulfonyl chloride |
| N-Trifluoracetyl-sulfanilsaeurechlorid |
| 4-trifluoroacetamido benzenesulfonyl chloride |
| p-trifluoroacetamidobenzenesulfonyl chloride |