Introduction:Basic information about CAS 64496-66-8|Salafibrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Salafibrate |
|---|
| CAS Number | 64496-66-8 | Molecular Weight | 647.49600 |
|---|
| Density | 1.299g/cm3 | Boiling Point | 699.4ºC at 760 mmHg |
|---|
| Molecular Formula | C32H32Cl2O10 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 195.8ºC |
|---|
Names
| Name | 1,3-bis[[2-(4-chlorophenoxy)-2-methylpropanoyl]oxy]propan-2-yl 2-acetyloxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.299g/cm3 |
|---|
| Boiling Point | 699.4ºC at 760 mmHg |
|---|
| Molecular Formula | C32H32Cl2O10 |
|---|
| Molecular Weight | 647.49600 |
|---|
| Flash Point | 195.8ºC |
|---|
| Exact Mass | 646.13700 |
|---|
| PSA | 123.66000 |
|---|
| LogP | 6.24570 |
|---|
| Index of Refraction | 1.561 |
|---|
| InChIKey | GVOWJSGFINMTQK-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1ccccc1C(=O)OC(COC(=O)C(C)(C)Oc1ccc(Cl)cc1)COC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
|---|
Synonyms
| Salafibratum |
| Salafibrato |
| 2-(2-Acetoxybenzoyloxy)trimethylen bis(2-(4-chlorphenoxy)-2-methylpropionat) |
| Salafibrate |