Introduction：Basic information about CAS 169037-23-4|5-Trifluoromethoxyisatin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Trifluoromethoxyisatin |
|---|
| CAS Number | 169037-23-4 | Molecular Weight | 231.128 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C9H4F3NO3 | Melting Point | 170-172 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | 5-(trifluoromethoxy)isatin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Melting Point | 170-172 °C(lit.) |
|---|
| Molecular Formula | C9H4F3NO3 |
|---|
| Molecular Weight | 231.128 |
|---|
| Exact Mass | 231.014328 |
|---|
| PSA | 55.40000 |
|---|
| LogP | 1.51 |
|---|
| Index of Refraction | 1.514 |
|---|
| InChIKey | XHAJMVPMNOBILF-UHFFFAOYSA-N |
|---|
| SMILES | O=C1Nc2ccc(OC(F)(F)F)cc2C1=O |
|---|
| Storage condition | Keep Cold |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-(Trifluoromethoxy)-1H-indole-2,3-dione |
| 5-(Trifluoromethoxy)indoline-2,3-dione |
| 1H-Indole-2,3-dione, 5-(trifluoromethoxy)- |
| 5-Trifluoromethoxy-1H-indole-2,3-dione |
| 5-(TrifluoroMethoxy)isatin |
| 5-Trifluoromethoxyisatin |
| 5-(Trifluoromethoxy)-2,3-indolinedione |
| 5-(Trifluoromethoxy)indole-2,3-dione |
| MFCD00192524 |
