Introduction：Basic information about CAS 13365-26-9|dimethyl 3-nitrophthalate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dimethyl 3-nitrophthalate |
|---|
| CAS Number | 13365-26-9 | Molecular Weight | 239.18200 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 314.6ºC at 760mmHg |
|---|
| Molecular Formula | C10H9NO6 | Melting Point | 68-69°C |
|---|
| MSDS | / | Flash Point | 134.3ºC |
|---|
Names
| Name | dimethyl 3-nitrobenzene-1,2-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 314.6ºC at 760mmHg |
|---|
| Melting Point | 68-69°C |
|---|
| Molecular Formula | C10H9NO6 |
|---|
| Molecular Weight | 239.18200 |
|---|
| Flash Point | 134.3ºC |
|---|
| Exact Mass | 239.04300 |
|---|
| PSA | 98.42000 |
|---|
| LogP | 1.69120 |
|---|
| Vapour Pressure | 0.000462mmHg at 25°C |
|---|
| Index of Refraction | 1.549 |
|---|
| InChIKey | MLQMIKSBTAZNBK-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cccc([N+](=O)[O-])c1C(=O)OC |
|---|
Safety Information
| Safety Phrases | S22-S24/25 |
|---|
| HS Code | 2917399090 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| dimethyl 3-nitro-phthalate |
| Dimethyl 3-nitrophthalate |
| HMS542N19 |
| 3-Nitro-phthalsaeure-dimethylester |
| MFCD00017184 |
| 3-nitrophthalic acid dimethyl ester |
